| MolName | 2,2-bis(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxyacetamide |
| MolecularFormula | C21H15N2O2Cl3 |
| Smiles | OC(C(N/N=C\c(cc1)ccc1Cl)=O)(c(cc1)ccc1Cl)c(cc1)ccc1Cl |
| InChI | InChI=1S/C21H15Cl3N2O2/c22-17-7-1-14(2-8-17)13-25-26-20(27)21(28,15-3-9-18(23)10-4-15)16-5-11-19(24)12-6-16/h1-13,28H,(H,26,27) |
| InChIK | MODLUSZQMWHWRZ-UHFFFAOYSA-N |
| TotalMolweight | 433.721 |
| Molweight | 433.721 |
| MonoisotopicMass | 432.019909 |
| CLogP | 5.2999 |
| CLogS | -6.635 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 309.77 |
| Relative PSA | 0.15854 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 5.4615 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - 2,2-bis(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxyacetamide | 2 - 2,2-bis(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-hydroxyacetamide