| MolName | 1-(2-chlorophenothiazin-10-yl)-2-[3-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]indol-1-yl]ethanone |
| MolecularFormula | C36H36N9OClS |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1)N1c(cc(cc2)Cl)c2Sc2c1cccc2 |
| InChI | InChI=1S/C36H36ClN9OS/c37-26-15-16-32-30(21-26)46(29-13-5-6-14-31(29)48-32)33(47)24-45-23-25(27-11-3-4-12-28(27)45)22-38-42-34-39-35(43-17-7-1-8-18-43)41-36(40-34)44-19-9-2-10-20-44/h3-6,11-16,21-23H,1-2,7-10,17-20,24H2,(H,39,40,41,42) |
| InChIK | MODMFYUEQJWIAT-UHFFFAOYSA-N |
| TotalMolweight | 678.263 |
| Molweight | 678.263 |
| MonoisotopicMass | 677.245203 |
| CLogP | 9.8889 |
| CLogS | -9.918 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 501.26 |
| Relative PSA | 0.20734 |
| PolarSurfaceArea | 120.08 |
| Druglikeness | 3.9481 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.41667 |
| Fragments | 1 |
| Non HAtoms | 48 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 8 |
| Small Rings | 8 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 12 |
| Symmetricatoms | 10 |
| Amides | 1 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-chlorophenothiazin-10-yl)-2-[3-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]indol-1-yl]ethanone | 2 - 1-(2-chlorophenothiazin-10-yl)-2-[3-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]indol-1-yl]ethanone