| MolName | 4-amino-N-[(Z)-(4,5-dibromothiophen-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C8H5N5O2Br2S |
| Smiles | Nc1nonc1C(N/N=C\c(s1)cc(Br)c1Br)=O |
| InChI | InChI=1S/C8H5Br2N5O2S/c9-4-1-3(18-6(4)10)2-12-13-8(16)5-7(11)15-17-14-5/h1-2H,(H2,11,15)(H,13,16) |
| InChIK | MOJWCWTYARLMDM-UHFFFAOYSA-N |
| TotalMolweight | 395.035 |
| Molweight | 395.035 |
| MonoisotopicMass | 392.853067 |
| CLogP | 2.9627 |
| CLogS | -4.284 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 215.92 |
| Relative PSA | 0.49875 |
| PolarSurfaceArea | 134.64 |
| Druglikeness | 1.914 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(4,5-dibromothiophen-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-(4,5-dibromothiophen-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide