| MolName | [1-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
| MolecularFormula | C30H21N2O3Cl |
| Smiles | O=C(Cc1cccc2ccccc12)N/N=C\c(c1ccccc1cc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C30H21ClN2O3/c31-24-15-12-22(13-16-24)30(35)36-28-17-14-21-7-2-4-11-26(21)27(28)19-32-33-29(34)18-23-9-5-8-20-6-1-3-10-25(20)23/h1-17,19H,18H2,(H,33,34) |
| InChIK | MOKDRIYCZIXQEH-UHFFFAOYSA-N |
| TotalMolweight | 492.961 |
| Molweight | 492.961 |
| MonoisotopicMass | 492.12407 |
| CLogP | 7.625 |
| CLogS | -9.104 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 372.88 |
| Relative PSA | 0.15836 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 4.0798 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate | 2 - [1-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate