| MolName | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C12H12N2O2F2 |
| Smiles | O=C(C1CC1)N/N=C\c(cccc1)c1OC(F)F |
| InChI | InChI=1S/C12H12F2N2O2/c13-12(14)18-10-4-2-1-3-9(10)7-15-16-11(17)8-5-6-8/h1-4,7-8,12H,5-6H2,(H,16,17) |
| InChIK | MOVZDHAHXMKENT-UHFFFAOYSA-N |
| TotalMolweight | 254.235 |
| Molweight | 254.235 |
| MonoisotopicMass | 254.086684 |
| CLogP | 2.2453 |
| CLogS | -3.689 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 188.95 |
| Relative PSA | 0.2435 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.8027 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]cyclopropanecarboxamide