| MolName | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C32H22N4O6Cl2S |
| Smiles | N#Cc1c(NC(C(N/N=C\c(ccc(OC(c(cc2)ccc2Cl)=O)c2)c2OC(c(cc2)ccc2Cl)=O)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C32H22Cl2N4O6S/c33-21-10-5-18(6-11-21)31(41)43-23-14-9-20(26(15-23)44-32(42)19-7-12-22(34)13-8-19)17-36-38-29(40)28(39)37-30-25(16-35)24-3-1-2-4-27(24)45-30/h5-15,17H,1-4H2,(H,37,39)(H,38,40) |
| InChIK | MOXPHNYMKQNOFH-UHFFFAOYSA-N |
| TotalMolweight | 661.521 |
| Molweight | 661.521 |
| MonoisotopicMass | 660.06371 |
| CLogP | 7.2655 |
| CLogS | -9.962 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 481.25 |
| Relative PSA | 0.29197 |
| PolarSurfaceArea | 175.19 |
| Druglikeness | -4.4322 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.48889 |
| Fragments | 1 |
| Non HAtoms | 45 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate