| MolName | 4-N,6-N-diphenyl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C23H18N7F3 |
| Smiles | FC(c1c(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cccc1)(F)F |
| InChI | InChI=1S/C23H18F3N7/c24-23(25,26)19-14-8-7-9-16(19)15-27-33-22-31-20(28-17-10-3-1-4-11-17)30-21(32-22)29-18-12-5-2-6-13-18/h1-15H,(H3,28,29,30,31,32,33) |
| InChIK | MPXXGOZXIGCONM-UHFFFAOYSA-N |
| TotalMolweight | 449.439 |
| Molweight | 449.439 |
| MonoisotopicMass | 449.157577 |
| CLogP | 8.1716 |
| CLogS | -7.269 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 337.42 |
| Relative PSA | 0.23354 |
| PolarSurfaceArea | 87.12 |
| Druglikeness | -4.6306 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 13 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,6-N-diphenyl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine | 2 - 4-N,6-N-diphenyl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine