2-[2-[(Z)-(cyclopropanecarbonylhydrazinylidene)methyl]phenoxy]acetic acid
Formula:C13H14N2O4
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
2-[2-[(Z)-(cyclopropanecarbonylhydrazinylidene)methyl]phenoxy]acetic acid is a drug-like molecule.
| MolName | 2-[2-[(Z)-(cyclopropanecarbonylhydrazinylidene)methyl]phenoxy]acetic acid |
| MolecularFormula | C13H14N2O4 |
| Smiles | OC(COc1c(/C=N\NC(C2CC2)=O)cccc1)=O |
| InChI | InChI=1S/C13H14N2O4/c16-12(17)8-19-11-4-2-1-3-10(11)7-14-15-13(18)9-5-6-9/h1-4,7,9H,5-6,8H2,(H,15,18)(H,16,17) |
| InChIK | MQVYOCSBIKTJNC-UHFFFAOYSA-N |
| TotalMolweight | 262.264 |
| Molweight | 262.264 |
| MonoisotopicMass | 262.095358 |
| CLogP | 1.1359 |
| CLogS | -2.86 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 201.61 |
| Relative PSA | 0.35787 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 5.5593 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-(cyclopropanecarbonylhydrazinylidene)methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-(cyclopropanecarbonylhydrazinylidene)methyl]phenoxy]acetic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off