| MolName | N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzenesulfonamide |
| MolecularFormula | C15H14N2O2S |
| Smiles | O=S(c1ccccc1)(N/N=C\C=C\c1ccccc1)=O |
| InChI | InChI=1S/C15H14N2O2S/c18-20(19,15-11-5-2-6-12-15)17-16-13-7-10-14-8-3-1-4-9-14/h1-13,17H |
| InChIK | MQXWTRJXHQZYJH-UHFFFAOYSA-N |
| TotalMolweight | 286.354 |
| Molweight | 286.354 |
| MonoisotopicMass | 286.077598 |
| CLogP | 2.2954 |
| CLogS | -2.208 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 224.32 |
| Relative PSA | 0.22981 |
| PolarSurfaceArea | 66.91 |
| Druglikeness | -6.21 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzenesulfonamide | 2 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzenesulfonamide