| MolName | (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C11H8N4O2F4 |
| Smiles | FC(Oc1cc(OC(F)F)c(/C=N\n2cnnc2)cc1)F |
| InChI | InChI=1S/C11H8F4N4O2/c12-10(13)20-8-2-1-7(9(3-8)21-11(14)15)4-18-19-5-16-17-6-19/h1-6,10-11H |
| InChIK | MRGOXJHSXDPPPQ-UHFFFAOYSA-N |
| TotalMolweight | 304.203 |
| Molweight | 304.203 |
| MonoisotopicMass | 304.058338 |
| CLogP | 1.5671 |
| CLogS | -5.554 |
| H Acceptors | 6 |
| TotalSurfaceArea | 214.9 |
| Relative PSA | 0.28069 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | 0.69093 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine