| MolName | N-[(Z)-[(3aS,7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methylideneamino]-6-bromo-4-phenylquinazolin-2-amine |
| MolecularFormula | C22H17N6Br |
| Smiles | Brc1cc2c(-c3ccccc3)nc(N/N=C\C3=N[C@H]4C=CC=C[C@H]4N3)nc2cc1 |
| InChI | InChI=1S/C22H17BrN6/c23-15-10-11-17-16(12-15)21(14-6-2-1-3-7-14)28-22(27-17)29-24-13-20-25-18-8-4-5-9-19(18)26-20/h1-13,18-19H,(H,25,26)(H,27,28,29)/t18-,19+ |
| InChIK | MRIWSMUGFITXNQ-KDURUIRLSA-N |
| TotalMolweight | 445.323 |
| Molweight | 445.323 |
| MonoisotopicMass | 444.069805 |
| CLogP | 4.809 |
| CLogS | -5.876 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 305.42 |
| Relative PSA | 0.22225 |
| PolarSurfaceArea | 74.56 |
| Druglikeness | 1.5091 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 2 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(Z)-[(3aS,7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methylideneamino]-6-bromo-4-phenylquinazolin-2-amine | 2 - N-[(Z)-[(3aS,7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methylideneamino]-6-bromo-4-phenylquinazolin-2-amine