| MolName | (1S,2R,6S,7R,8R,10S)-4-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| MolecularFormula | C22H16N3O5Cl |
| Smiles | [O-][N+](c(cc(cc1)Cl)c1-c1ccc(/C=N\N(C([C@H]2[C@@H]([C@H]3[C@@H]4C3)C=C[C@@H]4[C@@H]22)=O)C2=O)o1)=O |
| InChI | InChI=1S/C22H16ClN3O5/c23-10-1-3-14(17(7-10)26(29)30)18-6-2-11(31-18)9-24-25-21(27)19-12-4-5-13(16-8-15(12)16)20(19)22(25)28/h1-7,9,12-13,15-16,19-20H,8H2/t12-,13+,15-,16-,19-,20+/m0/s1 |
| InChIK | MRXNDZGLIVZYFX-QPXCPLOPSA-N |
| TotalMolweight | 437.838 |
| Molweight | 437.838 |
| MonoisotopicMass | 437.077849 |
| CLogP | 2.6072 |
| CLogS | -6.33 |
| H Acceptors | 8 |
| TotalSurfaceArea | 293.62 |
| Relative PSA | 0.29177 |
| PolarSurfaceArea | 108.7 |
| Druglikeness | 2.2603 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 9 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1S,2R,6S,7R,8R,10S)-4-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione | 2 - (1S,2R,6S,7R,8R,10S)-4-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione