| MolName | 4-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]phenol |
| MolecularFormula | C13H10N2OCl2 |
| Smiles | Oc(cc1)ccc1N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C13H10Cl2N2O/c14-10-2-1-9(13(15)7-10)8-16-17-11-3-5-12(18)6-4-11/h1-8,17-18H |
| InChIK | MSMOKPSRUKUTPG-UHFFFAOYSA-N |
| TotalMolweight | 281.141 |
| Molweight | 281.141 |
| MonoisotopicMass | 280.017017 |
| CLogP | 5.7072 |
| CLogS | -4.325 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 206.43 |
| Relative PSA | 0.17473 |
| PolarSurfaceArea | 44.62 |
| Druglikeness | 2.1704 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]phenol | 2 - 4-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]phenol