| MolName | 4-hydroxy-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C16H13N3O4 |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(c(cc2)ccc2O)=O)cccc1)=O |
| InChI | InChI=1S/C16H13N3O4/c20-14-9-7-13(8-10-14)16(21)18-17-11-3-5-12-4-1-2-6-15(12)19(22)23/h1-11,20H,(H,18,21) |
| InChIK | MSMUKYMVHCPDPU-UHFFFAOYSA-N |
| TotalMolweight | 311.296 |
| Molweight | 311.296 |
| MonoisotopicMass | 311.090607 |
| CLogP | 1.9526 |
| CLogS | -4.177 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 243.51 |
| Relative PSA | 0.3266 |
| PolarSurfaceArea | 107.51 |
| Druglikeness | -0.73272 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-hydroxy-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide | 2 - 4-hydroxy-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide