| MolName | (Z)-1-(2,3-dihydro-1H-inden-5-yl)-N-[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]methanimine |
| MolecularFormula | C20H20N2 |
| Smiles | C(C1)Cc2c1ccc(/C=N\N=C/c1cc(CCC3)c3cc1)c2 |
| InChI | InChI=1S/C20H20N2/c1-3-17-9-7-15(11-19(17)5-1)13-21-22-14-16-8-10-18-4-2-6-20(18)12-16/h7-14H,1-6H2 |
| InChIK | MTDMQIPYYJFPMB-UHFFFAOYSA-N |
| TotalMolweight | 288.393 |
| Molweight | 288.393 |
| MonoisotopicMass | 288.162648 |
| CLogP | 6.4152 |
| CLogS | -5.776 |
| H Acceptors | 2 |
| TotalSurfaceArea | 238.1 |
| Relative PSA | 0.096682 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | -1.4108 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2,3-dihydro-1H-inden-5-yl)-N-[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]methanimine | 2 - (Z)-1-(2,3-dihydro-1H-inden-5-yl)-N-[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]methanimine