| MolName | 4-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H15N6ClS2 |
| Smiles | S=C(NN=C1c2cccs2)N1/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1Cl |
| InChI | InChI=1S/C22H15ClN6S2/c23-17-10-8-15(9-11-17)20-16(14-28(27-20)18-5-2-1-3-6-18)13-24-29-21(25-26-22(29)30)19-7-4-12-31-19/h1-14H,(H,26,30) |
| InChIK | MTGUYTRWFBBULD-UHFFFAOYSA-N |
| TotalMolweight | 462.988 |
| Molweight | 462.988 |
| MonoisotopicMass | 462.048811 |
| CLogP | 4.6866 |
| CLogS | -6.71 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 340.56 |
| Relative PSA | 0.30605 |
| PolarSurfaceArea | 118.14 |
| Druglikeness | 5.6965 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.45161 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione