| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine |
| MolecularFormula | C18H14N3O2ClS |
| Smiles | Clc1c(/C=N\Nc2nc(-c(cc3)cc4c3OCCO4)cs2)cccc1 |
| InChI | InChI=1S/C18H14ClN3O2S/c19-14-4-2-1-3-13(14)10-20-22-18-21-15(11-25-18)12-5-6-16-17(9-12)24-8-7-23-16/h1-6,9-11H,7-8H2,(H,21,22) |
| InChIK | MTMVHKHACAOFSH-UHFFFAOYSA-N |
| TotalMolweight | 371.847 |
| Molweight | 371.847 |
| MonoisotopicMass | 371.049524 |
| CLogP | 6.8012 |
| CLogS | -5.578 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 273.14 |
| Relative PSA | 0.27202 |
| PolarSurfaceArea | 83.98 |
| Druglikeness | -3.3287 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine