| MolName | N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| MolecularFormula | C21H16N2O2BrF |
| Smiles | OC(C(N/N=C\c(cc(cc1)Br)c1F)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16BrFN2O2/c22-18-11-12-19(23)15(13-18)14-24-25-20(26)21(27,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,27H,(H,25,26) |
| InChIK | MTPVDBGHRRMIJO-UHFFFAOYSA-N |
| TotalMolweight | 427.272 |
| Molweight | 427.272 |
| MonoisotopicMass | 426.037917 |
| CLogP | 4.3079 |
| CLogS | -5.575 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 288.49 |
| Relative PSA | 0.17023 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 2.3083 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48148 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide | 2 - N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide