| MolName | N-[(Z)-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
| MolecularFormula | C26H19N4O2ClF4S |
| Smiles | O=C(Cc1csc(Nc2cc(C(F)(F)F)ccc2)n1)N/N=C\c(cc1)cc(Cl)c1OCc(cccc1)c1F |
| InChI | InChI=1S/C26H19ClF4N4O2S/c27-21-10-16(8-9-23(21)37-14-17-4-1-2-7-22(17)28)13-32-35-24(36)12-20-15-38-25(34-20)33-19-6-3-5-18(11-19)26(29,30)31/h1-11,13,15H,12,14H2,(H,33,34)(H,35,36) |
| InChIK | MTTCCHUNGIBABO-UHFFFAOYSA-N |
| TotalMolweight | 562.974 |
| Molweight | 562.974 |
| MonoisotopicMass | 562.085335 |
| CLogP | 7.3126 |
| CLogS | -8.19 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 401.42 |
| Relative PSA | 0.22121 |
| PolarSurfaceArea | 103.85 |
| Druglikeness | -1.6384 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide | 2 - N-[(Z)-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide