| MolName | (2Z)-1,2-diphenyl-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]ethanone |
| MolecularFormula | C19H14N2OS |
| Smiles | O=C(/C(/c1ccccc1)=N\N=C/c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C19H14N2OS/c22-19(16-10-5-2-6-11-16)18(15-8-3-1-4-9-15)21-20-14-17-12-7-13-23-17/h1-14H |
| InChIK | MUDOBYXNAYUBCX-UHFFFAOYSA-N |
| TotalMolweight | 318.399 |
| Molweight | 318.399 |
| MonoisotopicMass | 318.082683 |
| CLogP | 5.1437 |
| CLogS | -5.818 |
| H Acceptors | 3 |
| TotalSurfaceArea | 254.2 |
| Relative PSA | 0.22195 |
| PolarSurfaceArea | 70.03 |
| Druglikeness | 4.5862 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-1,2-diphenyl-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]ethanone | 2 - (2Z)-1,2-diphenyl-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]ethanone