| MolName | 1-[(3-bromophenyl)methyl]-N-[(Z)-naphthalen-2-ylmethylideneamino]-4-nitropyrazole-3-carboxamide |
| MolecularFormula | C22H16N5O3Br |
| Smiles | [O-][N+](c1cn(Cc2cccc(Br)c2)nc1C(N/N=C\c1cc2ccccc2cc1)=O)=O |
| InChI | InChI=1S/C22H16BrN5O3/c23-19-7-3-4-16(11-19)13-27-14-20(28(30)31)21(26-27)22(29)25-24-12-15-8-9-17-5-1-2-6-18(17)10-15/h1-12,14H,13H2,(H,25,29) |
| InChIK | MUEXMSLQKCTUCS-UHFFFAOYSA-N |
| TotalMolweight | 478.305 |
| Molweight | 478.305 |
| MonoisotopicMass | 477.043651 |
| CLogP | 3.6734 |
| CLogS | -6.202 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 325.37 |
| Relative PSA | 0.259 |
| PolarSurfaceArea | 105.1 |
| Druglikeness | 0.35167 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(3-bromophenyl)methyl]-N-[(Z)-naphthalen-2-ylmethylideneamino]-4-nitropyrazole-3-carboxamide | 2 - 1-[(3-bromophenyl)methyl]-N-[(Z)-naphthalen-2-ylmethylideneamino]-4-nitropyrazole-3-carboxamide