| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-(benzimidazol-1-yl)acetamide |
| MolecularFormula | C24H18N4O |
| Smiles | O=C(Cn1c(cccc2)c2nc1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C24H18N4O/c29-24(15-28-16-25-22-11-5-6-12-23(22)28)27-26-14-21-19-9-3-1-7-17(19)13-18-8-2-4-10-20(18)21/h1-14,16H,15H2,(H,27,29) |
| InChIK | MUTBXJZISBTZSS-UHFFFAOYSA-N |
| TotalMolweight | 378.434 |
| Molweight | 378.434 |
| MonoisotopicMass | 378.148061 |
| CLogP | 4.8174 |
| CLogS | -6.274 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 292.51 |
| Relative PSA | 0.1841 |
| PolarSurfaceArea | 59.28 |
| Druglikeness | 6.3893 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-(benzimidazol-1-yl)acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-(benzimidazol-1-yl)acetamide