| MolName | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C16H14N2O4 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(cc1)cc2c1OCCO2)=O |
| InChI | InChI=1S/C16H14N2O4/c19-13-4-2-1-3-12(13)16(20)18-17-10-11-5-6-14-15(9-11)22-8-7-21-14/h1-6,9-10,19H,7-8H2,(H,18,20) |
| InChIK | MVRJSULCGIYGRQ-UHFFFAOYSA-N |
| TotalMolweight | 298.297 |
| Molweight | 298.297 |
| MonoisotopicMass | 298.095358 |
| CLogP | 2.8347 |
| CLogS | -3.607 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 227.36 |
| Relative PSA | 0.30397 |
| PolarSurfaceArea | 80.15 |
| Druglikeness | -2.8756 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-hydroxybenzamide