| MolName | N-(2-chlorophenyl)-5-nitro-2-[(2E)-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]benzenesulfonamide |
| MolecularFormula | C31H21N6O6ClS |
| Smiles | [O-][N+](c(cc1)cc(S(Nc(cccc2)c2Cl)(=O)=O)c1N/N=C/c1cn(-c2ccccc2)nc1C1=Cc(cccc2)c2OC1=O)=O |
| InChI | InChI=1S/C31H21ClN6O6S/c32-25-11-5-6-12-26(25)36-45(42,43)29-17-23(38(40)41)14-15-27(29)34-33-18-21-19-37(22-9-2-1-3-10-22)35-30(21)24-16-20-8-4-7-13-28(20)44-31(24)39/h1-19,34,36H |
| InChIK | MVVHMKTTXAXFSG-UHFFFAOYSA-N |
| TotalMolweight | 641.063 |
| Molweight | 641.063 |
| MonoisotopicMass | 640.093181 |
| CLogP | 5.1402 |
| CLogS | -7.148 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 454.57 |
| Relative PSA | 0.29547 |
| PolarSurfaceArea | 168.88 |
| Druglikeness | 0.68224 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.42222 |
| Fragments | 1 |
| Non HAtoms | 45 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-chlorophenyl)-5-nitro-2-[(2E)-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]benzenesulfonamide | 2 - N-(2-chlorophenyl)-5-nitro-2-[(2E)-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]benzenesulfonamide