| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide |
| MolecularFormula | C22H17N3O4S |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c1cccs1 |
| InChI | InChI=1S/C22H17N3O4S/c26-21(16-5-2-1-3-6-16)24-18(22(27)25-23-13-17-7-4-10-30-17)11-15-8-9-19-20(12-15)29-14-28-19/h1-13H,14H2,(H,24,26)(H,25,27) |
| InChIK | MWAHESJJPGDAMD-UHFFFAOYSA-N |
| TotalMolweight | 419.46 |
| Molweight | 419.46 |
| MonoisotopicMass | 419.093977 |
| CLogP | 4.7963 |
| CLogS | -6.187 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 316.87 |
| Relative PSA | 0.31833 |
| PolarSurfaceArea | 117.26 |
| Druglikeness | 7.4876 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide