| MolName | N-[(Z)-(2-iodophenyl)methylideneamino]-1H-indole-3-carboxamide |
| MolecularFormula | C16H12N3OI |
| Smiles | O=C(c1c[nH]c2c1cccc2)N/N=C\c(cccc1)c1I |
| InChI | InChI=1S/C16H12IN3O/c17-14-7-3-1-5-11(14)9-19-20-16(21)13-10-18-15-8-4-2-6-12(13)15/h1-10,18H,(H,20,21) |
| InChIK | MWSRFZUYZFVMHW-UHFFFAOYSA-N |
| TotalMolweight | 389.191 |
| Molweight | 389.191 |
| MonoisotopicMass | 389.00251 |
| CLogP | 3.6781 |
| CLogS | -5.262 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 237.44 |
| Relative PSA | 0.21058 |
| PolarSurfaceArea | 57.25 |
| Druglikeness | 5.8637 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-iodophenyl)methylideneamino]-1H-indole-3-carboxamide | 2 - N-[(Z)-(2-iodophenyl)methylideneamino]-1H-indole-3-carboxamide