| MolName | 2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-naphthalen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C32H26N6OS |
| Smiles | O=C(CSc1nnc(CNc2cccc3ccccc23)n1-c1ccccc1)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C32H26N6OS/c39-31(36-34-20-23-17-18-24-9-4-5-11-26(24)19-23)22-40-32-37-35-30(38(32)27-13-2-1-3-14-27)21-33-29-16-8-12-25-10-6-7-15-28(25)29/h1-20,33H,21-22H2,(H,36,39) |
| InChIK | MWWSDELDWXJZMJ-UHFFFAOYSA-N |
| TotalMolweight | 542.665 |
| Molweight | 542.665 |
| MonoisotopicMass | 542.188879 |
| CLogP | 6.2322 |
| CLogS | -10.15 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 418.9 |
| Relative PSA | 0.22385 |
| PolarSurfaceArea | 109.5 |
| Druglikeness | 5.8676 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-naphthalen-2-ylmethylideneamino]acetamide | 2 - 2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-naphthalen-2-ylmethylideneamino]acetamide