| MolName | [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| MolecularFormula | C31H23N3O4 |
| Smiles | O=C(CNC(c1cccc2ccccc12)=O)N/N=C\c(cc1)ccc1OC(c1cccc2ccccc12)=O |
| InChI | InChI=1S/C31H23N3O4/c35-29(20-32-30(36)27-13-5-9-22-7-1-3-11-25(22)27)34-33-19-21-15-17-24(18-16-21)38-31(37)28-14-6-10-23-8-2-4-12-26(23)28/h1-19H,20H2,(H,32,36)(H,34,35) |
| InChIK | MXBRRNMDJANONX-UHFFFAOYSA-N |
| TotalMolweight | 501.541 |
| Molweight | 501.541 |
| MonoisotopicMass | 501.168857 |
| CLogP | 6.1046 |
| CLogS | -8.17 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 386.67 |
| Relative PSA | 0.21608 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.0531 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60526 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate