| MolName | (Z)-N-carbazol-9-yl-1-[2-(difluoromethoxy)phenyl]methanimine |
| MolecularFormula | C20H14N2OF2 |
| Smiles | FC(Oc1c(/C=N\n2c(cccc3)c3c3c2cccc3)cccc1)F |
| InChI | InChI=1S/C20H14F2N2O/c21-20(22)25-19-12-6-1-7-14(19)13-23-24-17-10-4-2-8-15(17)16-9-3-5-11-18(16)24/h1-13,20H |
| InChIK | MXJZFVXPNXYTBP-UHFFFAOYSA-N |
| TotalMolweight | 336.34 |
| Molweight | 336.34 |
| MonoisotopicMass | 336.107419 |
| CLogP | 4.9841 |
| CLogS | -8.008 |
| H Acceptors | 3 |
| TotalSurfaceArea | 251.38 |
| Relative PSA | 0.1129 |
| PolarSurfaceArea | 26.52 |
| Druglikeness | 0.24 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 2 |
| Symmetricatoms | 7 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-carbazol-9-yl-1-[2-(difluoromethoxy)phenyl]methanimine | 2 - (Z)-N-carbazol-9-yl-1-[2-(difluoromethoxy)phenyl]methanimine