| MolName | N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide |
| MolecularFormula | C19H15N7O6S |
| Smiles | [O-][N+](c1c(/C=N\NC(Cc2nnc(NC(Nc3ccccc3)=O)s2)=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C19H15N7O6S/c27-16(23-20-9-11-6-14-15(32-10-31-14)7-13(11)26(29)30)8-17-24-25-19(33-17)22-18(28)21-12-4-2-1-3-5-12/h1-7,9H,8,10H2,(H,23,27)(H2,21,22,25,28) |
| InChIK | MYUPPARVIVGUFD-UHFFFAOYSA-N |
| TotalMolweight | 469.437 |
| Molweight | 469.437 |
| MonoisotopicMass | 469.080453 |
| CLogP | 2.3739 |
| CLogS | -6.092 |
| H Acceptors | 13 |
| H Donors | 3 |
| TotalSurfaceArea | 338.57 |
| Relative PSA | 0.48643 |
| PolarSurfaceArea | 200.89 |
| Druglikeness | 1.3421 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide | 2 - N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide