| MolName | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]acetamide |
| MolecularFormula | C19H15N5O2 |
| Smiles | Nc1nonc1CC(N/N=C\c1c(cccc2)c2cc2ccccc12)=O |
| InChI | InChI=1S/C19H15N5O2/c20-19-17(23-26-24-19)10-18(25)22-21-11-16-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)16/h1-9,11H,10H2,(H2,20,24)(H,22,25) |
| InChIK | MYYQOPGSKIOARM-UHFFFAOYSA-N |
| TotalMolweight | 345.361 |
| Molweight | 345.361 |
| MonoisotopicMass | 345.122575 |
| CLogP | 3.8279 |
| CLogS | -5.766 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 265.68 |
| Relative PSA | 0.3287 |
| PolarSurfaceArea | 106.4 |
| Druglikeness | 5.3442 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]acetamide | 2 - 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]acetamide