| MolName | 4-(4-bromophenyl)-N-[(Z)-(3-bromophenyl)methylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C16H11N3Br2S |
| Smiles | Brc(cc1)ccc1-c1csc(N/N=C\c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C16H11Br2N3S/c17-13-6-4-12(5-7-13)15-10-22-16(20-15)21-19-9-11-2-1-3-14(18)8-11/h1-10H,(H,20,21) |
| InChIK | MZLYJDQTRITRKC-UHFFFAOYSA-N |
| TotalMolweight | 437.158 |
| Molweight | 437.158 |
| MonoisotopicMass | 434.904039 |
| CLogP | 7.6668 |
| CLogS | -6.328 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 260.96 |
| Relative PSA | 0.20808 |
| PolarSurfaceArea | 65.52 |
| Druglikeness | 2.2081 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(4-bromophenyl)-N-[(Z)-(3-bromophenyl)methylideneamino]-1,3-thiazol-2-amine | 2 - 4-(4-bromophenyl)-N-[(Z)-(3-bromophenyl)methylideneamino]-1,3-thiazol-2-amine