| MolName | 4-(azepan-1-ylsulfonyl)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C18H21N3O3S2 |
| Smiles | O=C(c(cc1)ccc1S(N1CCCCCC1)(=O)=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C18H21N3O3S2/c22-18(20-19-14-16-6-5-13-25-16)15-7-9-17(10-8-15)26(23,24)21-11-3-1-2-4-12-21/h5-10,13-14H,1-4,11-12H2,(H,20,22) |
| InChIK | MZOAZSJGWWUCLI-UHFFFAOYSA-N |
| TotalMolweight | 391.515 |
| Molweight | 391.515 |
| MonoisotopicMass | 391.102432 |
| CLogP | 3.617 |
| CLogS | -4.096 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 290.87 |
| Relative PSA | 0.30426 |
| PolarSurfaceArea | 115.46 |
| Druglikeness | 3.5019 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(azepan-1-ylsulfonyl)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide | 2 - 4-(azepan-1-ylsulfonyl)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide