| MolName | 4,6-bis(azepan-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C21H30N8 |
| Smiles | C(CCC1)CCN1c1nc(N/N=C\c2cnccc2)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C21H30N8/c1-2-6-13-28(12-5-1)20-24-19(27-23-17-18-10-9-11-22-16-18)25-21(26-20)29-14-7-3-4-8-15-29/h9-11,16-17H,1-8,12-15H2,(H,24,25,26,27) |
| InChIK | MZPIMWIDGROWNI-UHFFFAOYSA-N |
| TotalMolweight | 394.525 |
| Molweight | 394.525 |
| MonoisotopicMass | 394.259342 |
| CLogP | 5.6116 |
| CLogS | -5.064 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 323 |
| Relative PSA | 0.22895 |
| PolarSurfaceArea | 82.43 |
| Druglikeness | 0.31944 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-bis(azepan-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-bis(azepan-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine