| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C22H18N9O2F3 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc(C(F)(F)F)c2)=O)c1CN(CC1)c2c1cccc2 |
| InChI | InChI=1S/C22H18F3N9O2/c23-22(24,25)15-6-3-4-13(10-15)11-27-29-21(35)18-17(34(32-28-18)20-19(26)30-36-31-20)12-33-9-8-14-5-1-2-7-16(14)33/h1-7,10-11H,8-9,12H2,(H2,26,30)(H,29,35) |
| InChIK | MZTHWRODEZCYGW-UHFFFAOYSA-N |
| TotalMolweight | 497.44 |
| Molweight | 497.44 |
| MonoisotopicMass | 497.153555 |
| CLogP | 4.0496 |
| CLogS | -3.938 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 356.5 |
| Relative PSA | 0.33574 |
| PolarSurfaceArea | 140.35 |
| Druglikeness | -3.7842 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide