| MolName | 2-(2-phenoxyethoxy)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide |
| MolecularFormula | C29H24N4O3S |
| Smiles | O=C(c(cccc1)c1OCCOc1ccccc1)N/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C29H24N4O3S/c34-29(25-14-7-8-15-26(25)36-18-17-35-24-12-5-2-6-13-24)31-30-20-22-21-33(23-10-3-1-4-11-23)32-28(22)27-16-9-19-37-27/h1-16,19-21H,17-18H2,(H,31,34) |
| InChIK | MZUJIAANNWPOKZ-UHFFFAOYSA-N |
| TotalMolweight | 508.601 |
| Molweight | 508.601 |
| MonoisotopicMass | 508.156911 |
| CLogP | 5.4991 |
| CLogS | -6.423 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 397.69 |
| Relative PSA | 0.23689 |
| PolarSurfaceArea | 105.98 |
| Druglikeness | 0.073862 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-phenoxyethoxy)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide | 2 - 2-(2-phenoxyethoxy)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide