| MolName | N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| MolecularFormula | C22H18N4O2 |
| Smiles | O=C(c(cc1)cc2c1nc[nH]2)N/N=C\c1cc(OCc2ccccc2)ccc1 |
| InChI | InChI=1S/C22H18N4O2/c27-22(18-9-10-20-21(12-18)24-15-23-20)26-25-13-17-7-4-8-19(11-17)28-14-16-5-2-1-3-6-16/h1-13,15H,14H2,(H,23,24)(H,26,27) |
| InChIK | MZXJNPLLWFTZFT-UHFFFAOYSA-N |
| TotalMolweight | 370.411 |
| Molweight | 370.411 |
| MonoisotopicMass | 370.142976 |
| CLogP | 4.1493 |
| CLogS | -5.273 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 293.44 |
| Relative PSA | 0.24186 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 4.5549 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide | 2 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide