| MolName | 1-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| MolecularFormula | C15H18N4O3S |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(NC[C@H]2OCCC2)=S)cccc1)=O |
| InChI | InChI=1S/C15H18N4O3S/c20-19(21)14-8-2-1-5-12(14)6-3-9-17-18-15(23)16-11-13-7-4-10-22-13/h1-3,5-6,8-9,13H,4,7,10-11H2,(H2,16,18,23)/t13-/m0/s1 |
| InChIK | NAAPXWDTZKJNLA-ZDUSSCGKSA-N |
| TotalMolweight | 334.399 |
| Molweight | 334.399 |
| MonoisotopicMass | 334.109961 |
| CLogP | 1.28 |
| CLogS | -4.251 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 267.86 |
| Relative PSA | 0.38397 |
| PolarSurfaceArea | 123.56 |
| Druglikeness | -3.492 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 1-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea | 2 - 1-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea