| MolName | N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| MolecularFormula | C24H19N2O3F2P |
| Smiles | O=P1(C=C(c2ccccc2)OC(c2ccccc2)=C1)N/N=C\c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C24H19F2N2O3P/c25-24(26)30-21-13-11-18(12-14-21)15-27-28-32(29)16-22(19-7-3-1-4-8-19)31-23(17-32)20-9-5-2-6-10-20/h1-17,24H,(H,28,29) |
| InChIK | NACVMZWTXCRGTA-UHFFFAOYSA-N |
| TotalMolweight | 452.396 |
| Molweight | 452.396 |
| MonoisotopicMass | 452.110136 |
| CLogP | 4.9494 |
| CLogS | -4.183 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 333.89 |
| Relative PSA | 0.17967 |
| PolarSurfaceArea | 69.73 |
| Druglikeness | -14.812 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 13 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine | 2 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine