| MolName | N-[4-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide |
| MolecularFormula | C21H16N4O2S |
| Smiles | O=C(c1ccccc1)Nc(cc1)ccc1-c1csc(N/N=C\c2ccco2)n1 |
| InChI | InChI=1S/C21H16N4O2S/c26-20(16-5-2-1-3-6-16)23-17-10-8-15(9-11-17)19-14-28-21(24-19)25-22-13-18-7-4-12-27-18/h1-14H,(H,23,26)(H,24,25) |
| InChIK | NAJCZGTYNHIIFZ-UHFFFAOYSA-N |
| TotalMolweight | 388.45 |
| Molweight | 388.45 |
| MonoisotopicMass | 388.099396 |
| CLogP | 6.5526 |
| CLogS | -5.854 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 302.36 |
| Relative PSA | 0.30728 |
| PolarSurfaceArea | 107.76 |
| Druglikeness | 4.4659 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[4-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide | 2 - N-[4-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide