| MolName | N-[(Z)-[2-(2-nitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide |
| MolecularFormula | C17H12N4O4S |
| Smiles | [O-][N+](c(cccc1)c1Oc1c(/C=N\NC(c2cscn2)=O)cccc1)=O |
| InChI | InChI=1S/C17H12N4O4S/c22-17(13-10-26-11-18-13)20-19-9-12-5-1-3-7-15(12)25-16-8-4-2-6-14(16)21(23)24/h1-11H,(H,20,22) |
| InChIK | NAPCFSYAMDBBGM-UHFFFAOYSA-N |
| TotalMolweight | 368.372 |
| Molweight | 368.372 |
| MonoisotopicMass | 368.057926 |
| CLogP | 2.5069 |
| CLogS | -5.495 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 275.12 |
| Relative PSA | 0.39168 |
| PolarSurfaceArea | 137.64 |
| Druglikeness | 0.36498 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(2-nitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide | 2 - N-[(Z)-[2-(2-nitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-4-carboxamide