| MolName | [4-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| MolecularFormula | C20H15N2O4FS |
| Smiles | O=C(COc(cc1)ccc1F)N/N=C\c(cc1)ccc1OC(c1cccs1)=O |
| InChI | InChI=1S/C20H15FN2O4S/c21-15-5-9-16(10-6-15)26-13-19(24)23-22-12-14-3-7-17(8-4-14)27-20(25)18-2-1-11-28-18/h1-12H,13H2,(H,23,24) |
| InChIK | NAQDWQRHRRRGLO-UHFFFAOYSA-N |
| TotalMolweight | 398.413 |
| Molweight | 398.413 |
| MonoisotopicMass | 398.073656 |
| CLogP | 4.1744 |
| CLogS | -5.295 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 300.55 |
| Relative PSA | 0.29749 |
| PolarSurfaceArea | 105.23 |
| Druglikeness | 4.6054 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate | 2 - [4-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate