| MolName | N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
| MolecularFormula | C18H10N2O2BrCl2F7 |
| Smiles | O=C(C(C(C(F)(F)F)(F)F)(F)F)N/N=C\c(cc(cc1)Br)c1OCc(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C18H10BrCl2F7N2O2/c19-11-2-4-14(32-8-9-1-3-12(20)6-13(9)21)10(5-11)7-29-30-15(31)16(22,23)17(24,25)18(26,27)28/h1-7H,8H2,(H,30,31) |
| InChIK | NBDKKXLHEVKYCV-UHFFFAOYSA-N |
| TotalMolweight | 570.085 |
| Molweight | 570.085 |
| MonoisotopicMass | 567.919089 |
| CLogP | 6.9454 |
| CLogS | -8.374 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 335.9 |
| Relative PSA | 0.13698 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | -84.093 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide | 2 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide