| MolName | 5-chloro-N-[(Z)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C20H13N3O2ClF |
| Smiles | O=C(c1cc(cc(cc2)Cl)c2o1)N/N=C\c1cccn1-c(cccc1)c1F |
| InChI | InChI=1S/C20H13ClFN3O2/c21-14-7-8-18-13(10-14)11-19(27-18)20(26)24-23-12-15-4-3-9-25(15)17-6-2-1-5-16(17)22/h1-12H,(H,24,26) |
| InChIK | NBSOBVBCLRSMRA-UHFFFAOYSA-N |
| TotalMolweight | 381.793 |
| Molweight | 381.793 |
| MonoisotopicMass | 381.068032 |
| CLogP | 4.6529 |
| CLogS | -8.291 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 282.01 |
| Relative PSA | 0.20209 |
| PolarSurfaceArea | 59.53 |
| Druglikeness | 4.1837 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-chloro-N-[(Z)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - 5-chloro-N-[(Z)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]-1-benzofuran-2-carboxamide