| MolName | 4-[(2Z)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]benzoic acid |
| MolecularFormula | C25H20N2O3 |
| Smiles | OC(c(cc1)ccc1N/N=C\c1cc(OCc2cccc3ccccc23)ccc1)=O |
| InChI | InChI=1S/C25H20N2O3/c28-25(29)20-11-13-22(14-12-20)27-26-16-18-5-3-9-23(15-18)30-17-21-8-4-7-19-6-1-2-10-24(19)21/h1-16,27H,17H2,(H,28,29) |
| InChIK | NBUFBNMUFSNSDU-UHFFFAOYSA-N |
| TotalMolweight | 396.445 |
| Molweight | 396.445 |
| MonoisotopicMass | 396.147393 |
| CLogP | 6.8685 |
| CLogS | -6.109 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 311.46 |
| Relative PSA | 0.18978 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 1.5337 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]benzoic acid | 2 - 4-[(2Z)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]benzoic acid