| MolName | N-(2-chlorophenyl)-N'-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C22H18N3O3Cl |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1OCc1ccccc1)=O)Nc(cccc1)c1Cl |
| InChI | InChI=1S/C22H18ClN3O3/c23-19-8-4-5-9-20(19)25-21(27)22(28)26-24-14-16-10-12-18(13-11-16)29-15-17-6-2-1-3-7-17/h1-14H,15H2,(H,25,27)(H,26,28) |
| InChIK | NCLKRGOOQYDWOL-UHFFFAOYSA-N |
| TotalMolweight | 407.856 |
| Molweight | 407.856 |
| MonoisotopicMass | 407.103669 |
| CLogP | 4.098 |
| CLogS | -5.602 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 315.14 |
| Relative PSA | 0.22374 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 3.4149 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-chlorophenyl)-N'-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]oxamide | 2 - N-(2-chlorophenyl)-N'-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]oxamide