| MolName | 3-[5-[(Z)-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]furan-2-yl]benzoic acid |
| MolecularFormula | C27H22N2O4S |
| Smiles | OC(c1cccc(-c2ccc(/C=N\c3c(C(Nc4ccccc4)=O)c(CCCC4)c4s3)o2)c1)=O |
| InChI | InChI=1S/C27H22N2O4S/c30-25(29-19-9-2-1-3-10-19)24-21-11-4-5-12-23(21)34-26(24)28-16-20-13-14-22(33-20)17-7-6-8-18(15-17)27(31)32/h1-3,6-10,13-16H,4-5,11-12H2,(H,29,30)(H,31,32) |
| InChIK | NCTBIGCVQRREER-UHFFFAOYSA-N |
| TotalMolweight | 470.548 |
| Molweight | 470.548 |
| MonoisotopicMass | 470.130028 |
| CLogP | 5.8179 |
| CLogS | -7.395 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 357.78 |
| Relative PSA | 0.27005 |
| PolarSurfaceArea | 120.14 |
| Druglikeness | 0.81226 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]furan-2-yl]benzoic acid