| MolName | 3-(4-chlorophenyl)-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C21H15N4OClS |
| Smiles | S=C(NN=C1c(cc2)ccc2Cl)N1/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C21H15ClN4OS/c22-17-11-9-16(10-12-17)20-24-25-21(28)26(20)23-14-15-5-4-8-19(13-15)27-18-6-2-1-3-7-18/h1-14H,(H,25,28) |
| InChIK | NCWHXUDDPSZKKP-UHFFFAOYSA-N |
| TotalMolweight | 406.896 |
| Molweight | 406.896 |
| MonoisotopicMass | 406.065508 |
| CLogP | 5.2966 |
| CLogS | -7.484 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 306.9 |
| Relative PSA | 0.24774 |
| PolarSurfaceArea | 81.31 |
| Druglikeness | 3.4665 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-chlorophenyl)-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(4-chlorophenyl)-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione