| MolName | N-[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]pyridin-2-amine |
| MolecularFormula | C15H15N3 |
| Smiles | C(C1)Cc2c1ccc(/C=N\Nc1ncccc1)c2 |
| InChI | InChI=1S/C15H15N3/c1-2-9-16-15(6-1)18-17-11-12-7-8-13-4-3-5-14(13)10-12/h1-2,6-11H,3-5H2,(H,16,18) |
| InChIK | NDCXQSUCGVXSOD-UHFFFAOYSA-N |
| TotalMolweight | 237.305 |
| Molweight | 237.305 |
| MonoisotopicMass | 237.126597 |
| CLogP | 5.0062 |
| CLogS | -3.701 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 195.78 |
| Relative PSA | 0.17336 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | -0.75652 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]pyridin-2-amine | 2 - N-[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]pyridin-2-amine