| MolName | N-[(E)-(2-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| MolecularFormula | C14H6N2ClF7 |
| Smiles | FC(c(c(F)c(c(N/N=C/c(cccc1)c1Cl)c1F)F)c1F)(F)F |
| InChI | InChI=1S/C14H6ClF7N2/c15-7-4-2-1-3-6(7)5-23-24-13-11(18)9(16)8(14(20,21)22)10(17)12(13)19/h1-5,24H |
| InChIK | NDIIDYADOWZSLW-UHFFFAOYSA-N |
| TotalMolweight | 370.655 |
| Molweight | 370.655 |
| MonoisotopicMass | 370.010771 |
| CLogP | 6.6984 |
| CLogS | -5.919 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 239.52 |
| Relative PSA | 0.0959 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | -4.8055 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(2-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline | 2 - N-[(E)-(2-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline